C17H25N3O3S — CID 39886497
N-cyclooctyl-1,3-dimethyl-2-oxobenzimidazole-5-sulfonamide (PubChem CID 39886497) has the molecular formula C17H25N3O3S and a molecular weight of 351.47 g/mol. Its IUPAC name is N-cyclooctyl-1,3-dimethyl-2-oxobenzimidazole-5-sulfonamide.
| Compound Name | N-cyclooctyl-1,3-dimethyl-2-oxobenzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 39886497 |
| Molecular Formula | C17H25N3O3S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | N-cyclooctyl-1,3-dimethyl-2-oxobenzimidazole-5-sulfonamide |
| SMILES | Cn1c(=O)n(C)c2cc(S(=O)(=O)NC3CCCCCCC3)ccc21 |
| InChI | InChI=1S/C17H25N3O3S/c1-19-15-11-10-14(12-16(15)20(2)17(19)21)24(22,23)18-13-8-6-4-3-5-7-9-13/h10-13,18H,3-9H2,1-2H3 |
| InChIKey | CVSYIVYFCRAUGM-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |