C13H19NO4S2 — CID 6462647
N-cyclohexyl-3-methylsulfonylbenzenesulfonamide (PubChem CID 6462647) has the molecular formula C13H19NO4S2 and a molecular weight of 317.43 g/mol. Its IUPAC name is N-cyclohexyl-3-methylsulfonylbenzenesulfonamide.
| Compound Name | N-cyclohexyl-3-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 6462647 |
| Molecular Formula | C13H19NO4S2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | N-cyclohexyl-3-methylsulfonylbenzenesulfonamide |
| SMILES | CS(=O)(=O)c1cccc(S(=O)(=O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C13H19NO4S2/c1-19(15,16)12-8-5-9-13(10-12)20(17,18)14-11-6-3-2-4-7-11/h5,8-11,14H,2-4,6-7H2,1H3 |
| InChIKey | KVRPIVSKNORHNV-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |