C16H23NO6S3 — CID 38996571
N-cyclohexyl-3-[(3S)-1,1-dioxothiolan-3-yl]sulfonylbenzenesulfonamide (PubChem CID 38996571) has the molecular formula C16H23NO6S3 and a molecular weight of 421.56 g/mol. Its IUPAC name is N-cyclohexyl-3-[(3S)-1,1-dioxothiolan-3-yl]sulfonylbenzenesulfonamide.
| Compound Name | N-cyclohexyl-3-[(3S)-1,1-dioxothiolan-3-yl]sulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 38996571 |
| Molecular Formula | C16H23NO6S3 |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | N-cyclohexyl-3-[(3S)-1,1-dioxothiolan-3-yl]sulfonylbenzenesulfonamide |
| SMILES | O=S1(=O)CC[C@H](S(=O)(=O)c2cccc(S(=O)(=O)NC3CCCCC3)c2)C1 |
| InChI | InChI=1S/C16H23NO6S3/c18-24(19)10-9-16(12-24)25(20,21)14-7-4-8-15(11-14)26(22,23)17-13-5-2-1-3-6-13/h4,7-8,11,13,16-17H,1-3,5-6,9-10,12H2/t16-/m0/s1 |
| InChIKey | UQRQWGMDNPHXKE-INIZCTEOSA-N |
| XLogP | 1.26 |
| TPSA | 114.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |