C14H21NO6S3 — CID 42655920
N-tert-butyl-3-(1,1-dioxothiolan-3-yl)sulfonylbenzenesulfonamide (PubChem CID 42655920) has the molecular formula C14H21NO6S3 and a molecular weight of 395.52 g/mol. Its IUPAC name is N-tert-butyl-3-(1,1-dioxothiolan-3-yl)sulfonylbenzenesulfonamide.
| Compound Name | N-tert-butyl-3-(1,1-dioxothiolan-3-yl)sulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 42655920 |
| Molecular Formula | C14H21NO6S3 |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.05 |
| IUPAC Name | N-tert-butyl-3-(1,1-dioxothiolan-3-yl)sulfonylbenzenesulfonamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1cccc(S(=O)(=O)C2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C14H21NO6S3/c1-14(2,3)15-24(20,21)12-6-4-5-11(9-12)23(18,19)13-7-8-22(16,17)10-13/h4-6,9,13,15H,7-8,10H2,1-3H3 |
| InChIKey | ZQQQLPGYNWQHJW-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 114.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |