C16H16BrNO6S3 — CID 38996876
N-(2-bromophenyl)-3-[(3R)-1,1-dioxothiolan-3-yl]sulfonylbenzenesulfonamide (PubChem CID 38996876) has the molecular formula C16H16BrNO6S3 and a molecular weight of 494.41 g/mol. Its IUPAC name is N-(2-bromophenyl)-3-[(3R)-1,1-dioxothiolan-3-yl]sulfonylbenzenesulfonamide.
| Compound Name | N-(2-bromophenyl)-3-[(3R)-1,1-dioxothiolan-3-yl]sulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 38996876 |
| Molecular Formula | C16H16BrNO6S3 |
| Molecular Weight | 494.41 g/mol |
| Exact Mass | 492.93 |
| IUPAC Name | N-(2-bromophenyl)-3-[(3R)-1,1-dioxothiolan-3-yl]sulfonylbenzenesulfonamide |
| SMILES | O=S1(=O)CC[C@@H](S(=O)(=O)c2cccc(S(=O)(=O)Nc3ccccc3Br)c2)C1 |
| InChI | InChI=1S/C16H16BrNO6S3/c17-15-6-1-2-7-16(15)18-27(23,24)13-5-3-4-12(10-13)26(21,22)14-8-9-25(19,20)11-14/h1-7,10,14,18H,8-9,11H2/t14-/m1/s1 |
| InChIKey | ZHXQXYMUIJRTHI-CQSZACIVSA-N |
| XLogP | 2.21 |
| TPSA | 114.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.41 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |