C20H25NO6S3 — CID 42655533
N-benzyl-3-(1,1-dioxothiolan-3-yl)sulfonyl-N-propan-2-ylbenzenesulfonamide (PubChem CID 42655533) has the molecular formula C20H25NO6S3 and a molecular weight of 471.62 g/mol. Its IUPAC name is N-benzyl-3-(1,1-dioxothiolan-3-yl)sulfonyl-N-propan-2-ylbenzenesulfonamide.
| Compound Name | N-benzyl-3-(1,1-dioxothiolan-3-yl)sulfonyl-N-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 42655533 |
| Molecular Formula | C20H25NO6S3 |
| Molecular Weight | 471.62 g/mol |
| Exact Mass | 471.08 |
| IUPAC Name | N-benzyl-3-(1,1-dioxothiolan-3-yl)sulfonyl-N-propan-2-ylbenzenesulfonamide |
| SMILES | CC(C)N(Cc1ccccc1)S(=O)(=O)c1cccc(S(=O)(=O)C2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C20H25NO6S3/c1-16(2)21(14-17-7-4-3-5-8-17)30(26,27)19-10-6-9-18(13-19)29(24,25)20-11-12-28(22,23)15-20/h3-10,13,16,20H,11-12,14-15H2,1-2H3 |
| InChIKey | UXGOSJZGAJPOSE-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 105.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.62 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |