C13H19NO4S2 — CID 18593878
N-benzyl-N-ethyl-1,1-dioxothiolane-3-sulfonamide (PubChem CID 18593878) has the molecular formula C13H19NO4S2 and a molecular weight of 317.43 g/mol. Its IUPAC name is N-benzyl-N-ethyl-1,1-dioxothiolane-3-sulfonamide.
| Compound Name | N-benzyl-N-ethyl-1,1-dioxothiolane-3-sulfonamide |
|---|---|
| PubChem CID | 18593878 |
| Molecular Formula | C13H19NO4S2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | N-benzyl-N-ethyl-1,1-dioxothiolane-3-sulfonamide |
| SMILES | CCN(Cc1ccccc1)S(=O)(=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H19NO4S2/c1-2-14(10-12-6-4-3-5-7-12)20(17,18)13-8-9-19(15,16)11-13/h3-7,13H,2,8-11H2,1H3 |
| InChIKey | MKJAKCPIHYIIEE-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |