2-[(1,1-dioxothiolan-3-yl)sulfonyl-methylamino]benzoic acid

C12H15NO6S2 — CID 43172795

IUPAC2-[(1,1-dioxothiolan-3-yl)sulfonyl-methylamino]benzoic acid
SMILESCN(c1ccccc1C(=O)O)S(=O)(=O)C1CCS(=O)(=O)C1
InChIInChI=1S/C12H15NO6S2/c1-13(11-5-3-2-4-10(11)12(14)15)21(18,19)9-6-7-20(16,17)8-9/h2-5,9H,6-8H2,1H3,(H,14,15)
InChIKeyKJKUSCNSJSJVKY-UHFFFAOYSA-N
MW333.39 g/mol
LogP0.34
Rot. Bonds4

About 2-[(1,1-dioxothiolan-3-yl)sulfonyl-methylamino]benzoic acid

2-[(1,1-dioxothiolan-3-yl)sulfonyl-methylamino]benzoic acid (PubChem CID 43172795) has the molecular formula C12H15NO6S2 and a molecular weight of 333.39 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-3-yl)sulfonyl-methylamino]benzoic acid.

Molecular Properties

Compound Name2-[(1,1-dioxothiolan-3-yl)sulfonyl-methylamino]benzoic acid
PubChem CID43172795
Molecular FormulaC12H15NO6S2
Molecular Weight333.39 g/mol
Exact Mass333.03
IUPAC Name2-[(1,1-dioxothiolan-3-yl)sulfonyl-methylamino]benzoic acid
SMILESCN(c1ccccc1C(=O)O)S(=O)(=O)C1CCS(=O)(=O)C1
InChIInChI=1S/C12H15NO6S2/c1-13(11-5-3-2-4-10(11)12(14)15)21(18,19)9-6-7-20(16,17)8-9/h2-5,9H,6-8H2,1H3,(H,14,15)
InChIKeyKJKUSCNSJSJVKY-UHFFFAOYSA-N
XLogP0.34
TPSA108.82 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500333.39
LogP ≤ 50.34
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-[(1,1-dioxothiolan-3-yl)sulfonyl-methylamino]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(1,1-dioxothiolan-3-yl)sulfonyl-methylamino]benzoic acid?
The IUPAC name of 2-[(1,1-dioxothiolan-3-yl)sulfonyl-methylamino]benzoic acid (CID 43172795) is 2-[(1,1-dioxothiolan-3-yl)sulfonyl-methylamino]benzoic acid.
What is the SMILES notation for 2-[(1,1-dioxothiolan-3-yl)sulfonyl-methylamino]benzoic acid?
The canonical SMILES for 2-[(1,1-dioxothiolan-3-yl)sulfonyl-methylamino]benzoic acid is CN(c1ccccc1C(=O)O)S(=O)(=O)C1CCS(=O)(=O)C1.
What is the InChIKey of 2-[(1,1-dioxothiolan-3-yl)sulfonyl-methylamino]benzoic acid?
The InChIKey is KJKUSCNSJSJVKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO6S2/c1-13(11-5-3-2-4-10(11)12(14)15)21(18,19)9-6-7-20(16,17)8-9/h2-5,9H,6-8H2,1H3,(H,14,15).
What are the key properties of 2-[(1,1-dioxothiolan-3-yl)sulfonyl-methylamino]benzoic acid?
2-[(1,1-dioxothiolan-3-yl)sulfonyl-methylamino]benzoic acid has a molecular weight of 333.39 g/mol, XLogP of 0.34, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1,1-dioxothiolan-3-yl)sulfonyl-methylamino]benzoic acid is sourced from PubChem (CID 43172795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).