C12H15NO6S2 — CID 43172795
2-[(1,1-dioxothiolan-3-yl)sulfonyl-methylamino]benzoic acid (PubChem CID 43172795) has the molecular formula C12H15NO6S2 and a molecular weight of 333.39 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-3-yl)sulfonyl-methylamino]benzoic acid.
| Compound Name | 2-[(1,1-dioxothiolan-3-yl)sulfonyl-methylamino]benzoic acid |
|---|---|
| PubChem CID | 43172795 |
| Molecular Formula | C12H15NO6S2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | 2-[(1,1-dioxothiolan-3-yl)sulfonyl-methylamino]benzoic acid |
| SMILES | CN(c1ccccc1C(=O)O)S(=O)(=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H15NO6S2/c1-13(11-5-3-2-4-10(11)12(14)15)21(18,19)9-6-7-20(16,17)8-9/h2-5,9H,6-8H2,1H3,(H,14,15) |
| InChIKey | KJKUSCNSJSJVKY-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 108.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |