C13H20N2O4S2 — CID 106511503
N-(2-aminoethyl)-N-benzyl-1,1-dioxothiolane-3-sulfonamide (PubChem CID 106511503) has the molecular formula C13H20N2O4S2 and a molecular weight of 332.45 g/mol. Its IUPAC name is N-(2-aminoethyl)-N-benzyl-1,1-dioxothiolane-3-sulfonamide.
| Compound Name | N-(2-aminoethyl)-N-benzyl-1,1-dioxothiolane-3-sulfonamide |
|---|---|
| PubChem CID | 106511503 |
| Molecular Formula | C13H20N2O4S2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | N-(2-aminoethyl)-N-benzyl-1,1-dioxothiolane-3-sulfonamide |
| SMILES | NCCN(Cc1ccccc1)S(=O)(=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H20N2O4S2/c14-7-8-15(10-12-4-2-1-3-5-12)21(18,19)13-6-9-20(16,17)11-13/h1-5,13H,6-11,14H2 |
| InChIKey | UFJDJEHUAXJFAX-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |