C15H24N2O2S — CID 107365146
N'-benzyl-N'-(1,1-dioxothian-4-yl)propane-1,3-diamine (PubChem CID 107365146) has the molecular formula C15H24N2O2S and a molecular weight of 296.44 g/mol. Its IUPAC name is N'-benzyl-N'-(1,1-dioxothian-4-yl)propane-1,3-diamine.
| Compound Name | N'-benzyl-N'-(1,1-dioxothian-4-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 107365146 |
| Molecular Formula | C15H24N2O2S |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | N'-benzyl-N'-(1,1-dioxothian-4-yl)propane-1,3-diamine |
| SMILES | NCCCN(Cc1ccccc1)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C15H24N2O2S/c16-9-4-10-17(13-14-5-2-1-3-6-14)15-7-11-20(18,19)12-8-15/h1-3,5-6,15H,4,7-13,16H2 |
| InChIKey | TXFGXNZCYNHRQY-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |