C14H22N2O — CID 63937836
N'-benzyl-N'-(oxan-4-yl)ethane-1,2-diamine (PubChem CID 63937836) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is N'-benzyl-N'-(oxan-4-yl)ethane-1,2-diamine.
| Compound Name | N'-benzyl-N'-(oxan-4-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 63937836 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | N'-benzyl-N'-(oxan-4-yl)ethane-1,2-diamine |
| SMILES | NCCN(Cc1ccccc1)C1CCOCC1 |
| InChI | InChI=1S/C14H22N2O/c15-8-9-16(14-6-10-17-11-7-14)12-13-4-2-1-3-5-13/h1-5,14H,6-12,15H2 |
| InChIKey | SLUCGIKNEWBGHJ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |