C16H27ClN2O2S — CID 120584146
N-(2-aminoethyl)-N-benzyl-1-cyclohexylmethanesulfonamide;hydrochloride (PubChem CID 120584146) has the molecular formula C16H27ClN2O2S and a molecular weight of 346.92 g/mol. Its IUPAC name is N-(2-aminoethyl)-N-benzyl-1-cyclohexylmethanesulfonamide;hydrochloride.
| Compound Name | N-(2-aminoethyl)-N-benzyl-1-cyclohexylmethanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120584146 |
| Molecular Formula | C16H27ClN2O2S |
| Molecular Weight | 346.92 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | N-(2-aminoethyl)-N-benzyl-1-cyclohexylmethanesulfonamide;hydrochloride |
| SMILES | Cl.NCCN(Cc1ccccc1)S(=O)(=O)CC1CCCCC1 |
| InChI | InChI=1S/C16H26N2O2S.ClH/c17-11-12-18(13-15-7-3-1-4-8-15)21(19,20)14-16-9-5-2-6-10-16;/h1,3-4,7-8,16H,2,5-6,9-14,17H2;1H |
| InChIKey | GAPMGHLBDZGAOJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.92 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |