C15H26ClN3O2S — CID 120584167
N-(2-aminoethyl)-N-benzyl-3-methylpiperidine-1-sulfonamide;hydrochloride (PubChem CID 120584167) has the molecular formula C15H26ClN3O2S and a molecular weight of 347.91 g/mol. Its IUPAC name is N-(2-aminoethyl)-N-benzyl-3-methylpiperidine-1-sulfonamide;hydrochloride.
| Compound Name | N-(2-aminoethyl)-N-benzyl-3-methylpiperidine-1-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120584167 |
| Molecular Formula | C15H26ClN3O2S |
| Molecular Weight | 347.91 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | N-(2-aminoethyl)-N-benzyl-3-methylpiperidine-1-sulfonamide;hydrochloride |
| SMILES | CC1CCCN(S(=O)(=O)N(CCN)Cc2ccccc2)C1.Cl |
| InChI | InChI=1S/C15H25N3O2S.ClH/c1-14-6-5-10-17(12-14)21(19,20)18(11-9-16)13-15-7-3-2-4-8-15;/h2-4,7-8,14H,5-6,9-13,16H2,1H3;1H |
| InChIKey | ZPISFOMWZUUWPV-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.91 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |