C12H25N3O3S2 — CID 63285443
3-[2-methoxyethyl-(3-methylpiperidin-1-yl)sulfonylamino]propanethioamide (PubChem CID 63285443) has the molecular formula C12H25N3O3S2 and a molecular weight of 323.48 g/mol. Its IUPAC name is 3-[2-methoxyethyl-(3-methylpiperidin-1-yl)sulfonylamino]propanethioamide.
| Compound Name | 3-[2-methoxyethyl-(3-methylpiperidin-1-yl)sulfonylamino]propanethioamide |
|---|---|
| PubChem CID | 63285443 |
| Molecular Formula | C12H25N3O3S2 |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 3-[2-methoxyethyl-(3-methylpiperidin-1-yl)sulfonylamino]propanethioamide |
| SMILES | COCCN(CCC(N)=S)S(=O)(=O)N1CCCC(C)C1 |
| InChI | InChI=1S/C12H25N3O3S2/c1-11-4-3-6-15(10-11)20(16,17)14(8-9-18-2)7-5-12(13)19/h11H,3-10H2,1-2H3,(H2,13,19) |
| InChIKey | RXXOSFZBFQSDCQ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|