C9H18N2O5S — CID 54969399
2-[2-methoxyethyl(pyrrolidin-1-ylsulfonyl)amino]acetic acid (PubChem CID 54969399) has the molecular formula C9H18N2O5S and a molecular weight of 266.32 g/mol. Its IUPAC name is 2-[2-methoxyethyl(pyrrolidin-1-ylsulfonyl)amino]acetic acid.
| Compound Name | 2-[2-methoxyethyl(pyrrolidin-1-ylsulfonyl)amino]acetic acid |
|---|---|
| PubChem CID | 54969399 |
| Molecular Formula | C9H18N2O5S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 2-[2-methoxyethyl(pyrrolidin-1-ylsulfonyl)amino]acetic acid |
| SMILES | COCCN(CC(=O)O)S(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C9H18N2O5S/c1-16-7-6-11(8-9(12)13)17(14,15)10-4-2-3-5-10/h2-8H2,1H3,(H,12,13) |
| InChIKey | CLKQANCJWWOYIA-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |