C11H23N3O4S — CID 94798810
2-[2-methoxyethyl-[(3R)-3-methylpiperidin-1-yl]sulfonylamino]acetamide (PubChem CID 94798810) has the molecular formula C11H23N3O4S and a molecular weight of 293.39 g/mol. Its IUPAC name is 2-[2-methoxyethyl-[(3R)-3-methylpiperidin-1-yl]sulfonylamino]acetamide.
| Compound Name | 2-[2-methoxyethyl-[(3R)-3-methylpiperidin-1-yl]sulfonylamino]acetamide |
|---|---|
| PubChem CID | 94798810 |
| Molecular Formula | C11H23N3O4S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 2-[2-methoxyethyl-[(3R)-3-methylpiperidin-1-yl]sulfonylamino]acetamide |
| SMILES | COCCN(CC(N)=O)S(=O)(=O)N1CCC[C@@H](C)C1 |
| InChI | InChI=1S/C11H23N3O4S/c1-10-4-3-5-13(8-10)19(16,17)14(6-7-18-2)9-11(12)15/h10H,3-9H2,1-2H3,(H2,12,15)/t10-/m1/s1 |
| InChIKey | PTQKUQOGLMSGQB-SNVBAGLBSA-N |
| XLogP | -0.60 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |