C12H26N4O4S — CID 76993942
N'-hydroxy-3-[2-methoxyethyl-(3-methylpiperidin-1-yl)sulfonylamino]propanimidamide (PubChem CID 76993942) has the molecular formula C12H26N4O4S and a molecular weight of 322.43 g/mol. Its IUPAC name is N'-hydroxy-3-[2-methoxyethyl-(3-methylpiperidin-1-yl)sulfonylamino]propanimidamide.
| Compound Name | N'-hydroxy-3-[2-methoxyethyl-(3-methylpiperidin-1-yl)sulfonylamino]propanimidamide |
|---|---|
| PubChem CID | 76993942 |
| Molecular Formula | C12H26N4O4S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | N'-hydroxy-3-[2-methoxyethyl-(3-methylpiperidin-1-yl)sulfonylamino]propanimidamide |
| SMILES | COCCN(CCC(N)=NO)S(=O)(=O)N1CCCC(C)C1 |
| InChI | InChI=1S/C12H26N4O4S/c1-11-4-3-6-16(10-11)21(18,19)15(8-9-20-2)7-5-12(13)14-17/h11,17H,3-10H2,1-2H3,(H2,13,14) |
| InChIKey | KBBXHUXVMDVFLI-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 108.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|