C11H25N3O2S — CID 43136910
N-(3-aminopropyl)-N-ethyl-3-methylpiperidine-1-sulfonamide (PubChem CID 43136910) has the molecular formula C11H25N3O2S and a molecular weight of 263.41 g/mol. Its IUPAC name is N-(3-aminopropyl)-N-ethyl-3-methylpiperidine-1-sulfonamide.
| Compound Name | N-(3-aminopropyl)-N-ethyl-3-methylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 43136910 |
| Molecular Formula | C11H25N3O2S |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | N-(3-aminopropyl)-N-ethyl-3-methylpiperidine-1-sulfonamide |
| SMILES | CCN(CCCN)S(=O)(=O)N1CCCC(C)C1 |
| InChI | InChI=1S/C11H25N3O2S/c1-3-13(9-5-7-12)17(15,16)14-8-4-6-11(2)10-14/h11H,3-10,12H2,1-2H3 |
| InChIKey | ABTWUPKKXGAIPE-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |