C9H20N2O3S — CID 107225076
(3S)-N,N-diethyl-3-hydroxypiperidine-1-sulfonamide (PubChem CID 107225076) has the molecular formula C9H20N2O3S and a molecular weight of 236.34 g/mol. Its IUPAC name is (3S)-N,N-diethyl-3-hydroxypiperidine-1-sulfonamide.
| Compound Name | (3S)-N,N-diethyl-3-hydroxypiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 107225076 |
| Molecular Formula | C9H20N2O3S |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | (3S)-N,N-diethyl-3-hydroxypiperidine-1-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)N1CCC[C@H](O)C1 |
| InChI | InChI=1S/C9H20N2O3S/c1-3-10(4-2)15(13,14)11-7-5-6-9(12)8-11/h9,12H,3-8H2,1-2H3/t9-/m0/s1 |
| InChIKey | DRIPDXHKROCNDE-VIFPVBQESA-N |
| XLogP | 0.03 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |