C8H18N2O3S — CID 79031251
(3S)-N,N-diethyl-3-hydroxypyrrolidine-1-sulfonamide (PubChem CID 79031251) has the molecular formula C8H18N2O3S and a molecular weight of 222.31 g/mol. Its IUPAC name is (3S)-N,N-diethyl-3-hydroxypyrrolidine-1-sulfonamide.
| Compound Name | (3S)-N,N-diethyl-3-hydroxypyrrolidine-1-sulfonamide |
|---|---|
| PubChem CID | 79031251 |
| Molecular Formula | C8H18N2O3S |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | (3S)-N,N-diethyl-3-hydroxypyrrolidine-1-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)N1CC[C@H](O)C1 |
| InChI | InChI=1S/C8H18N2O3S/c1-3-9(4-2)14(12,13)10-6-5-8(11)7-10/h8,11H,3-7H2,1-2H3/t8-/m0/s1 |
| InChIKey | UWSUQDSPWPYVDJ-QMMMGPOBSA-N |
| XLogP | -0.36 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |