C10H22N2O3S — CID 114501631
N,N-diethyl-4-hydroxy-3-methylpiperidine-1-sulfonamide (PubChem CID 114501631) has the molecular formula C10H22N2O3S and a molecular weight of 250.36 g/mol. Its IUPAC name is N,N-diethyl-4-hydroxy-3-methylpiperidine-1-sulfonamide.
| Compound Name | N,N-diethyl-4-hydroxy-3-methylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 114501631 |
| Molecular Formula | C10H22N2O3S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | N,N-diethyl-4-hydroxy-3-methylpiperidine-1-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)N1CCC(O)C(C)C1 |
| InChI | InChI=1S/C10H22N2O3S/c1-4-11(5-2)16(14,15)12-7-6-10(13)9(3)8-12/h9-10,13H,4-8H2,1-3H3 |
| InChIKey | NQBXZVGDTPGZIU-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |