C13H26N2O3S — CID 114680633
N-cyclohexyl-4-hydroxy-N,3-dimethylpiperidine-1-sulfonamide (PubChem CID 114680633) has the molecular formula C13H26N2O3S and a molecular weight of 290.43 g/mol. Its IUPAC name is N-cyclohexyl-4-hydroxy-N,3-dimethylpiperidine-1-sulfonamide.
| Compound Name | N-cyclohexyl-4-hydroxy-N,3-dimethylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 114680633 |
| Molecular Formula | C13H26N2O3S |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | N-cyclohexyl-4-hydroxy-N,3-dimethylpiperidine-1-sulfonamide |
| SMILES | CC1CN(S(=O)(=O)N(C)C2CCCCC2)CCC1O |
| InChI | InChI=1S/C13H26N2O3S/c1-11-10-15(9-8-13(11)16)19(17,18)14(2)12-6-4-3-5-7-12/h11-13,16H,3-10H2,1-2H3 |
| InChIKey | UNVFVFLKILTOEU-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |