C12H26ClN3O2S — CID 119971798
3-(aminomethyl)-N-cyclohexyl-N-methylpyrrolidine-1-sulfonamide;hydrochloride (PubChem CID 119971798) has the molecular formula C12H26ClN3O2S and a molecular weight of 311.88 g/mol. Its IUPAC name is 3-(aminomethyl)-N-cyclohexyl-N-methylpyrrolidine-1-sulfonamide;hydrochloride.
| Compound Name | 3-(aminomethyl)-N-cyclohexyl-N-methylpyrrolidine-1-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119971798 |
| Molecular Formula | C12H26ClN3O2S |
| Molecular Weight | 311.88 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 3-(aminomethyl)-N-cyclohexyl-N-methylpyrrolidine-1-sulfonamide;hydrochloride |
| SMILES | CN(C1CCCCC1)S(=O)(=O)N1CCC(CN)C1.Cl |
| InChI | InChI=1S/C12H25N3O2S.ClH/c1-14(12-5-3-2-4-6-12)18(16,17)15-8-7-11(9-13)10-15;/h11-12H,2-10,13H2,1H3;1H |
| InChIKey | KHPZBUWJPQUUBY-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.88 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |