C9H22ClN3O2S — CID 119963738
4-(aminomethyl)-N-ethyl-N-methylpiperidine-1-sulfonamide;hydrochloride (PubChem CID 119963738) has the molecular formula C9H22ClN3O2S and a molecular weight of 271.81 g/mol. Its IUPAC name is 4-(aminomethyl)-N-ethyl-N-methylpiperidine-1-sulfonamide;hydrochloride.
| Compound Name | 4-(aminomethyl)-N-ethyl-N-methylpiperidine-1-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119963738 |
| Molecular Formula | C9H22ClN3O2S |
| Molecular Weight | 271.81 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 4-(aminomethyl)-N-ethyl-N-methylpiperidine-1-sulfonamide;hydrochloride |
| SMILES | CCN(C)S(=O)(=O)N1CCC(CN)CC1.Cl |
| InChI | InChI=1S/C9H21N3O2S.ClH/c1-3-11(2)15(13,14)12-6-4-9(8-10)5-7-12;/h9H,3-8,10H2,1-2H3;1H |
| InChIKey | SVJWSLJLAHETEV-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.81 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |