C11H24ClN3O2S — CID 119972063
[1-(2-methylpiperidin-1-yl)sulfonylpyrrolidin-3-yl]methanamine;hydrochloride (PubChem CID 119972063) has the molecular formula C11H24ClN3O2S and a molecular weight of 297.85 g/mol. Its IUPAC name is [1-(2-methylpiperidin-1-yl)sulfonylpyrrolidin-3-yl]methanamine;hydrochloride.
| Compound Name | [1-(2-methylpiperidin-1-yl)sulfonylpyrrolidin-3-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 119972063 |
| Molecular Formula | C11H24ClN3O2S |
| Molecular Weight | 297.85 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | [1-(2-methylpiperidin-1-yl)sulfonylpyrrolidin-3-yl]methanamine;hydrochloride |
| SMILES | CC1CCCCN1S(=O)(=O)N1CCC(CN)C1.Cl |
| InChI | InChI=1S/C11H23N3O2S.ClH/c1-10-4-2-3-6-14(10)17(15,16)13-7-5-11(8-12)9-13;/h10-11H,2-9,12H2,1H3;1H |
| InChIKey | PANXLVDUDANTND-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.85 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |