C13H25N3O3S — CID 47319363
2-[1-(2-methylpiperidin-1-yl)sulfonylpiperidin-4-yl]acetamide (PubChem CID 47319363) has the molecular formula C13H25N3O3S and a molecular weight of 303.43 g/mol. Its IUPAC name is 2-[1-(2-methylpiperidin-1-yl)sulfonylpiperidin-4-yl]acetamide.
| Compound Name | 2-[1-(2-methylpiperidin-1-yl)sulfonylpiperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 47319363 |
| Molecular Formula | C13H25N3O3S |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 2-[1-(2-methylpiperidin-1-yl)sulfonylpiperidin-4-yl]acetamide |
| SMILES | CC1CCCCN1S(=O)(=O)N1CCC(CC(N)=O)CC1 |
| InChI | InChI=1S/C13H25N3O3S/c1-11-4-2-3-7-16(11)20(18,19)15-8-5-12(6-9-15)10-13(14)17/h11-12H,2-10H2,1H3,(H2,14,17) |
| InChIKey | KAIHTUXQCWXJTB-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |