C12H25N3O2S — CID 94021502
1-methyl-4-[(2R)-2-methylpiperidin-1-yl]sulfonyl-1,4-diazepane (PubChem CID 94021502) has the molecular formula C12H25N3O2S and a molecular weight of 275.42 g/mol. Its IUPAC name is 1-methyl-4-[(2R)-2-methylpiperidin-1-yl]sulfonyl-1,4-diazepane.
| Compound Name | 1-methyl-4-[(2R)-2-methylpiperidin-1-yl]sulfonyl-1,4-diazepane |
|---|---|
| PubChem CID | 94021502 |
| Molecular Formula | C12H25N3O2S |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 1-methyl-4-[(2R)-2-methylpiperidin-1-yl]sulfonyl-1,4-diazepane |
| SMILES | C[C@@H]1CCCCN1S(=O)(=O)N1CCCN(C)CC1 |
| InChI | InChI=1S/C12H25N3O2S/c1-12-6-3-4-9-15(12)18(16,17)14-8-5-7-13(2)10-11-14/h12H,3-11H2,1-2H3/t12-/m1/s1 |
| InChIKey | GPMPISDEWQZDCM-GFCCVEGCSA-N |
| XLogP | 0.74 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |