C14H26N2O4S — CID 81308957
ethyl (3R)-1-(2-methylpiperidin-1-yl)sulfonylpiperidine-3-carboxylate (PubChem CID 81308957) has the molecular formula C14H26N2O4S and a molecular weight of 318.44 g/mol. Its IUPAC name is ethyl (3R)-1-(2-methylpiperidin-1-yl)sulfonylpiperidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-(2-methylpiperidin-1-yl)sulfonylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 81308957 |
| Molecular Formula | C14H26N2O4S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | ethyl (3R)-1-(2-methylpiperidin-1-yl)sulfonylpiperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN(S(=O)(=O)N2CCCCC2C)C1 |
| InChI | InChI=1S/C14H26N2O4S/c1-3-20-14(17)13-8-6-9-15(11-13)21(18,19)16-10-5-4-7-12(16)2/h12-13H,3-11H2,1-2H3/t12?,13-/m1/s1 |
| InChIKey | VNTOVZYXEOOLHQ-ZGTCLIOFSA-N |
| XLogP | 1.38 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |