C13H25N3O4S — CID 103576447
ethyl 1-(3-amino-4-methylpyrrolidin-1-yl)sulfonylpiperidine-3-carboxylate (PubChem CID 103576447) has the molecular formula C13H25N3O4S and a molecular weight of 319.43 g/mol. Its IUPAC name is ethyl 1-(3-amino-4-methylpyrrolidin-1-yl)sulfonylpiperidine-3-carboxylate.
| Compound Name | ethyl 1-(3-amino-4-methylpyrrolidin-1-yl)sulfonylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 103576447 |
| Molecular Formula | C13H25N3O4S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | ethyl 1-(3-amino-4-methylpyrrolidin-1-yl)sulfonylpiperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(S(=O)(=O)N2CC(C)C(N)C2)C1 |
| InChI | InChI=1S/C13H25N3O4S/c1-3-20-13(17)11-5-4-6-15(8-11)21(18,19)16-7-10(2)12(14)9-16/h10-12H,3-9,14H2,1-2H3 |
| InChIKey | BXTXVZYSMUZEQL-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |