C12H23NO4S — CID 115536187
ethyl (3S)-1-tert-butylsulfonylpiperidine-3-carboxylate (PubChem CID 115536187) has the molecular formula C12H23NO4S and a molecular weight of 277.39 g/mol. Its IUPAC name is ethyl (3S)-1-tert-butylsulfonylpiperidine-3-carboxylate.
| Compound Name | ethyl (3S)-1-tert-butylsulfonylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 115536187 |
| Molecular Formula | C12H23NO4S |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | ethyl (3S)-1-tert-butylsulfonylpiperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCCN(S(=O)(=O)C(C)(C)C)C1 |
| InChI | InChI=1S/C12H23NO4S/c1-5-17-11(14)10-7-6-8-13(9-10)18(15,16)12(2,3)4/h10H,5-9H2,1-4H3/t10-/m0/s1 |
| InChIKey | FZOSPJREBJXNPB-JTQLQIEISA-N |
| XLogP | 1.39 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |