C13H26N2O5S — CID 65112821
ethyl 1-[(2-hydroxy-2-methylbutyl)sulfamoyl]piperidine-3-carboxylate (PubChem CID 65112821) has the molecular formula C13H26N2O5S and a molecular weight of 322.43 g/mol. Its IUPAC name is ethyl 1-[(2-hydroxy-2-methylbutyl)sulfamoyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[(2-hydroxy-2-methylbutyl)sulfamoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 65112821 |
| Molecular Formula | C13H26N2O5S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | ethyl 1-[(2-hydroxy-2-methylbutyl)sulfamoyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(S(=O)(=O)NCC(C)(O)CC)C1 |
| InChI | InChI=1S/C13H26N2O5S/c1-4-13(3,17)10-14-21(18,19)15-8-6-7-11(9-15)12(16)20-5-2/h11,14,17H,4-10H2,1-3H3 |
| InChIKey | VQTIRTXEAGXEGZ-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |