C14H20N2O4S — CID 64591199
ethyl 1-(phenylsulfamoyl)piperidine-3-carboxylate (PubChem CID 64591199) has the molecular formula C14H20N2O4S and a molecular weight of 312.39 g/mol. Its IUPAC name is ethyl 1-(phenylsulfamoyl)piperidine-3-carboxylate.
| Compound Name | ethyl 1-(phenylsulfamoyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 64591199 |
| Molecular Formula | C14H20N2O4S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | ethyl 1-(phenylsulfamoyl)piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(S(=O)(=O)Nc2ccccc2)C1 |
| InChI | InChI=1S/C14H20N2O4S/c1-2-20-14(17)12-7-6-10-16(11-12)21(18,19)15-13-8-4-3-5-9-13/h3-5,8-9,12,15H,2,6-7,10-11H2,1H3 |
| InChIKey | OQFKVIMAXWPQKK-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |