C13H24N2O5S — CID 43589603
ethyl 1-[3-(hydroxymethyl)piperidin-1-yl]sulfonylpyrrolidine-2-carboxylate (PubChem CID 43589603) has the molecular formula C13H24N2O5S and a molecular weight of 320.41 g/mol. Its IUPAC name is ethyl 1-[3-(hydroxymethyl)piperidin-1-yl]sulfonylpyrrolidine-2-carboxylate.
| Compound Name | ethyl 1-[3-(hydroxymethyl)piperidin-1-yl]sulfonylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 43589603 |
| Molecular Formula | C13H24N2O5S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | ethyl 1-[3-(hydroxymethyl)piperidin-1-yl]sulfonylpyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)C1CCCN1S(=O)(=O)N1CCCC(CO)C1 |
| InChI | InChI=1S/C13H24N2O5S/c1-2-20-13(17)12-6-4-8-15(12)21(18,19)14-7-3-5-11(9-14)10-16/h11-12,16H,2-10H2,1H3 |
| InChIKey | JTHCOAMCFXMAHW-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |