C12H23N3O4S — CID 82755269
ethyl 1-[(2S)-2-methylpiperazin-1-yl]sulfonylpyrrolidine-2-carboxylate (PubChem CID 82755269) has the molecular formula C12H23N3O4S and a molecular weight of 305.40 g/mol. Its IUPAC name is ethyl 1-[(2S)-2-methylpiperazin-1-yl]sulfonylpyrrolidine-2-carboxylate.
| Compound Name | ethyl 1-[(2S)-2-methylpiperazin-1-yl]sulfonylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 82755269 |
| Molecular Formula | C12H23N3O4S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | ethyl 1-[(2S)-2-methylpiperazin-1-yl]sulfonylpyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)C1CCCN1S(=O)(=O)N1CCNC[C@@H]1C |
| InChI | InChI=1S/C12H23N3O4S/c1-3-19-12(16)11-5-4-7-15(11)20(17,18)14-8-6-13-9-10(14)2/h10-11,13H,3-9H2,1-2H3/t10-,11?/m0/s1 |
| InChIKey | BDIMUMHJGSSQBM-VUWPPUDQSA-N |
| XLogP | -0.45 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |