C13H21NO6S — CID 103342838
2-(2-ethoxycarbonylpyrrolidin-1-yl)sulfonylcyclopentane-1-carboxylic acid (PubChem CID 103342838) has the molecular formula C13H21NO6S and a molecular weight of 319.38 g/mol. Its IUPAC name is 2-(2-ethoxycarbonylpyrrolidin-1-yl)sulfonylcyclopentane-1-carboxylic acid.
| Compound Name | 2-(2-ethoxycarbonylpyrrolidin-1-yl)sulfonylcyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 103342838 |
| Molecular Formula | C13H21NO6S |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 2-(2-ethoxycarbonylpyrrolidin-1-yl)sulfonylcyclopentane-1-carboxylic acid |
| SMILES | CCOC(=O)C1CCCN1S(=O)(=O)C1CCCC1C(=O)O |
| InChI | InChI=1S/C13H21NO6S/c1-2-20-13(17)10-6-4-8-14(10)21(18,19)11-7-3-5-9(11)12(15)16/h9-11H,2-8H2,1H3,(H,15,16) |
| InChIKey | AMVZHRCHUCAJMP-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |