C8H16N2O4S — CID 43362367
ethyl 1-(methylsulfamoyl)pyrrolidine-2-carboxylate (PubChem CID 43362367) has the molecular formula C8H16N2O4S and a molecular weight of 236.29 g/mol. Its IUPAC name is ethyl 1-(methylsulfamoyl)pyrrolidine-2-carboxylate.
| Compound Name | ethyl 1-(methylsulfamoyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 43362367 |
| Molecular Formula | C8H16N2O4S |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | ethyl 1-(methylsulfamoyl)pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)C1CCCN1S(=O)(=O)NC |
| InChI | InChI=1S/C8H16N2O4S/c1-3-14-8(11)7-5-4-6-10(7)15(12,13)9-2/h7,9H,3-6H2,1-2H3 |
| InChIKey | CJXJWQQJWBAOGM-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |