C11H21N3O4S — CID 62380091
ethyl 1-(pyrrolidin-3-ylsulfamoyl)pyrrolidine-2-carboxylate (PubChem CID 62380091) has the molecular formula C11H21N3O4S and a molecular weight of 291.37 g/mol. Its IUPAC name is ethyl 1-(pyrrolidin-3-ylsulfamoyl)pyrrolidine-2-carboxylate.
| Compound Name | ethyl 1-(pyrrolidin-3-ylsulfamoyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 62380091 |
| Molecular Formula | C11H21N3O4S |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | ethyl 1-(pyrrolidin-3-ylsulfamoyl)pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)C1CCCN1S(=O)(=O)NC1CCNC1 |
| InChI | InChI=1S/C11H21N3O4S/c1-2-18-11(15)10-4-3-7-14(10)19(16,17)13-9-5-6-12-8-9/h9-10,12-13H,2-8H2,1H3 |
| InChIKey | QHPGVMSUOSFXPW-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |