C9H17N3O5S — CID 64590448
ethyl 1-[(2-amino-2-oxoethyl)sulfamoyl]pyrrolidine-2-carboxylate (PubChem CID 64590448) has the molecular formula C9H17N3O5S and a molecular weight of 279.32 g/mol. Its IUPAC name is ethyl 1-[(2-amino-2-oxoethyl)sulfamoyl]pyrrolidine-2-carboxylate.
| Compound Name | ethyl 1-[(2-amino-2-oxoethyl)sulfamoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 64590448 |
| Molecular Formula | C9H17N3O5S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | ethyl 1-[(2-amino-2-oxoethyl)sulfamoyl]pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)C1CCCN1S(=O)(=O)NCC(N)=O |
| InChI | InChI=1S/C9H17N3O5S/c1-2-17-9(14)7-4-3-5-12(7)18(15,16)11-6-8(10)13/h7,11H,2-6H2,1H3,(H2,10,13) |
| InChIKey | RPUAAPRTLWWFOA-UHFFFAOYSA-N |
| XLogP | -1.67 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |