C12H22N2O6S — CID 103848070
ethyl 1-[(3-hydroxyoxolan-3-yl)methylsulfamoyl]pyrrolidine-2-carboxylate (PubChem CID 103848070) has the molecular formula C12H22N2O6S and a molecular weight of 322.38 g/mol. Its IUPAC name is ethyl 1-[(3-hydroxyoxolan-3-yl)methylsulfamoyl]pyrrolidine-2-carboxylate.
| Compound Name | ethyl 1-[(3-hydroxyoxolan-3-yl)methylsulfamoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 103848070 |
| Molecular Formula | C12H22N2O6S |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | ethyl 1-[(3-hydroxyoxolan-3-yl)methylsulfamoyl]pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)C1CCCN1S(=O)(=O)NCC1(O)CCOC1 |
| InChI | InChI=1S/C12H22N2O6S/c1-2-20-11(15)10-4-3-6-14(10)21(17,18)13-8-12(16)5-7-19-9-12/h10,13,16H,2-9H2,1H3 |
| InChIKey | JUXUEYXIBGPDKW-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |