C12H25N3O3S — CID 82744611
3-(aminomethyl)-N-methyl-N-(2-methyloxolan-3-yl)piperidine-1-sulfonamide (PubChem CID 82744611) has the molecular formula C12H25N3O3S and a molecular weight of 291.42 g/mol. Its IUPAC name is 3-(aminomethyl)-N-methyl-N-(2-methyloxolan-3-yl)piperidine-1-sulfonamide.
| Compound Name | 3-(aminomethyl)-N-methyl-N-(2-methyloxolan-3-yl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 82744611 |
| Molecular Formula | C12H25N3O3S |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 3-(aminomethyl)-N-methyl-N-(2-methyloxolan-3-yl)piperidine-1-sulfonamide |
| SMILES | CC1OCCC1N(C)S(=O)(=O)N1CCCC(CN)C1 |
| InChI | InChI=1S/C12H25N3O3S/c1-10-12(5-7-18-10)14(2)19(16,17)15-6-3-4-11(8-13)9-15/h10-12H,3-9,13H2,1-2H3 |
| InChIKey | DOQGTNMKUCTJME-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |