C10H22N2O2S — CID 63688999
(1-tert-butylsulfonylpiperidin-3-yl)methanamine (PubChem CID 63688999) has the molecular formula C10H22N2O2S and a molecular weight of 234.36 g/mol. Its IUPAC name is (1-tert-butylsulfonylpiperidin-3-yl)methanamine.
| Compound Name | (1-tert-butylsulfonylpiperidin-3-yl)methanamine |
|---|---|
| PubChem CID | 63688999 |
| Molecular Formula | C10H22N2O2S |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | (1-tert-butylsulfonylpiperidin-3-yl)methanamine |
| SMILES | CC(C)(C)S(=O)(=O)N1CCCC(CN)C1 |
| InChI | InChI=1S/C10H22N2O2S/c1-10(2,3)15(13,14)12-6-4-5-9(7-11)8-12/h9H,4-8,11H2,1-3H3 |
| InChIKey | QPNRGJCHEFJSMI-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |