C10H21FN2O2S — CID 112565048
2-fluoro-2-methyl-3-(1-methylsulfonylpiperidin-3-yl)propan-1-amine (PubChem CID 112565048) has the molecular formula C10H21FN2O2S and a molecular weight of 252.35 g/mol. Its IUPAC name is 2-fluoro-2-methyl-3-(1-methylsulfonylpiperidin-3-yl)propan-1-amine.
| Compound Name | 2-fluoro-2-methyl-3-(1-methylsulfonylpiperidin-3-yl)propan-1-amine |
|---|---|
| PubChem CID | 112565048 |
| Molecular Formula | C10H21FN2O2S |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 2-fluoro-2-methyl-3-(1-methylsulfonylpiperidin-3-yl)propan-1-amine |
| SMILES | CC(F)(CN)CC1CCCN(S(C)(=O)=O)C1 |
| InChI | InChI=1S/C10H21FN2O2S/c1-10(11,8-12)6-9-4-3-5-13(7-9)16(2,14)15/h9H,3-8,12H2,1-2H3 |
| InChIKey | AKGIITXBZKWYEH-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |