C14H28N2O4S — CID 106487613
ethyl 2-(aminomethyl)-2-[(1-methylsulfonylpiperidin-3-yl)methyl]butanoate (PubChem CID 106487613) has the molecular formula C14H28N2O4S and a molecular weight of 320.46 g/mol. Its IUPAC name is ethyl 2-(aminomethyl)-2-[(1-methylsulfonylpiperidin-3-yl)methyl]butanoate.
| Compound Name | ethyl 2-(aminomethyl)-2-[(1-methylsulfonylpiperidin-3-yl)methyl]butanoate |
|---|---|
| PubChem CID | 106487613 |
| Molecular Formula | C14H28N2O4S |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | ethyl 2-(aminomethyl)-2-[(1-methylsulfonylpiperidin-3-yl)methyl]butanoate |
| SMILES | CCOC(=O)C(CC)(CN)CC1CCCN(S(C)(=O)=O)C1 |
| InChI | InChI=1S/C14H28N2O4S/c1-4-14(11-15,13(17)20-5-2)9-12-7-6-8-16(10-12)21(3,18)19/h12H,4-11,15H2,1-3H3 |
| InChIKey | UHTVEGGOTILYQI-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |