C14H27NO4S — CID 116747630
3-ethyl-3-methoxy-1-(1-methylsulfonylpiperidin-3-yl)pentan-2-one (PubChem CID 116747630) has the molecular formula C14H27NO4S and a molecular weight of 305.44 g/mol. Its IUPAC name is 3-ethyl-3-methoxy-1-(1-methylsulfonylpiperidin-3-yl)pentan-2-one.
| Compound Name | 3-ethyl-3-methoxy-1-(1-methylsulfonylpiperidin-3-yl)pentan-2-one |
|---|---|
| PubChem CID | 116747630 |
| Molecular Formula | C14H27NO4S |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 3-ethyl-3-methoxy-1-(1-methylsulfonylpiperidin-3-yl)pentan-2-one |
| SMILES | CCC(CC)(OC)C(=O)CC1CCCN(S(C)(=O)=O)C1 |
| InChI | InChI=1S/C14H27NO4S/c1-5-14(6-2,19-3)13(16)10-12-8-7-9-15(11-12)20(4,17)18/h12H,5-11H2,1-4H3 |
| InChIKey | QAQLDLCNCXXPPD-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |