C15H27NO4S — CID 103450370
1-(1-hydroxycycloheptyl)-2-(1-methylsulfonylpiperidin-3-yl)ethanone (PubChem CID 103450370) has the molecular formula C15H27NO4S and a molecular weight of 317.45 g/mol. Its IUPAC name is 1-(1-hydroxycycloheptyl)-2-(1-methylsulfonylpiperidin-3-yl)ethanone.
| Compound Name | 1-(1-hydroxycycloheptyl)-2-(1-methylsulfonylpiperidin-3-yl)ethanone |
|---|---|
| PubChem CID | 103450370 |
| Molecular Formula | C15H27NO4S |
| Molecular Weight | 317.45 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 1-(1-hydroxycycloheptyl)-2-(1-methylsulfonylpiperidin-3-yl)ethanone |
| SMILES | CS(=O)(=O)N1CCCC(CC(=O)C2(O)CCCCCC2)C1 |
| InChI | InChI=1S/C15H27NO4S/c1-21(19,20)16-10-6-7-13(12-16)11-14(17)15(18)8-4-2-3-5-9-15/h13,18H,2-12H2,1H3 |
| InChIKey | MOAXQQDOWAZAPX-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.45 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |