C13H23NO4S — CID 79610502
4-hydroxy-4-[(1-methylsulfonylpiperidin-3-yl)methyl]cyclohexan-1-one (PubChem CID 79610502) has the molecular formula C13H23NO4S and a molecular weight of 289.40 g/mol. Its IUPAC name is 4-hydroxy-4-[(1-methylsulfonylpiperidin-3-yl)methyl]cyclohexan-1-one.
| Compound Name | 4-hydroxy-4-[(1-methylsulfonylpiperidin-3-yl)methyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 79610502 |
| Molecular Formula | C13H23NO4S |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 4-hydroxy-4-[(1-methylsulfonylpiperidin-3-yl)methyl]cyclohexan-1-one |
| SMILES | CS(=O)(=O)N1CCCC(CC2(O)CCC(=O)CC2)C1 |
| InChI | InChI=1S/C13H23NO4S/c1-19(17,18)14-8-2-3-11(10-14)9-13(16)6-4-12(15)5-7-13/h11,16H,2-10H2,1H3 |
| InChIKey | WRVSKMDCVVFIJV-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |