C10H19NO4S — CID 79612929
2-hydroxy-2-methyl-3-(1-methylsulfonylpiperidin-3-yl)propanal (PubChem CID 79612929) has the molecular formula C10H19NO4S and a molecular weight of 249.33 g/mol. Its IUPAC name is 2-hydroxy-2-methyl-3-(1-methylsulfonylpiperidin-3-yl)propanal.
| Compound Name | 2-hydroxy-2-methyl-3-(1-methylsulfonylpiperidin-3-yl)propanal |
|---|---|
| PubChem CID | 79612929 |
| Molecular Formula | C10H19NO4S |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 2-hydroxy-2-methyl-3-(1-methylsulfonylpiperidin-3-yl)propanal |
| SMILES | CC(O)(C=O)CC1CCCN(S(C)(=O)=O)C1 |
| InChI | InChI=1S/C10H19NO4S/c1-10(13,8-12)6-9-4-3-5-11(7-9)16(2,14)15/h8-9,13H,3-7H2,1-2H3 |
| InChIKey | KILAAHOQSDDQDP-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|