C10H21NO2S — CID 59148137
3-(2,2-dimethylpropyl)-1-methylsulfonylpyrrolidine (PubChem CID 59148137) has the molecular formula C10H21NO2S and a molecular weight of 219.35 g/mol. Its IUPAC name is 3-(2,2-dimethylpropyl)-1-methylsulfonylpyrrolidine.
| Compound Name | 3-(2,2-dimethylpropyl)-1-methylsulfonylpyrrolidine |
|---|---|
| PubChem CID | 59148137 |
| Molecular Formula | C10H21NO2S |
| Molecular Weight | 219.35 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 3-(2,2-dimethylpropyl)-1-methylsulfonylpyrrolidine |
| SMILES | CC(C)(C)CC1CCN(S(C)(=O)=O)C1 |
| InChI | InChI=1S/C10H21NO2S/c1-10(2,3)7-9-5-6-11(8-9)14(4,12)13/h9H,5-8H2,1-4H3 |
| InChIKey | GAVFGUXUHOLZRJ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.35 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |