C10H20INO2S — CID 88983075
3-(2,2-dimethylpropyl)piperidine-1-sulfonyl iodide (PubChem CID 88983075) has the molecular formula C10H20INO2S and a molecular weight of 345.25 g/mol. Its IUPAC name is 3-(2,2-dimethylpropyl)piperidine-1-sulfonyl iodide.
| Compound Name | 3-(2,2-dimethylpropyl)piperidine-1-sulfonyl iodide |
|---|---|
| PubChem CID | 88983075 |
| Molecular Formula | C10H20INO2S |
| Molecular Weight | 345.25 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | 3-(2,2-dimethylpropyl)piperidine-1-sulfonyl iodide |
| SMILES | CC(C)(C)CC1CCCN(S(=O)(=O)I)C1 |
| InChI | InChI=1S/C10H20INO2S/c1-10(2,3)7-9-5-4-6-12(8-9)15(11,13)14/h9H,4-8H2,1-3H3 |
| InChIKey | YOYITISGBJYRIM-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.25 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|