C14H28N4O3S — CID 119292580
4-(2-aminopropanoyl)-N-cyclohexyl-N-methylpiperazine-1-sulfonamide (PubChem CID 119292580) has the molecular formula C14H28N4O3S and a molecular weight of 332.47 g/mol. Its IUPAC name is 4-(2-aminopropanoyl)-N-cyclohexyl-N-methylpiperazine-1-sulfonamide.
| Compound Name | 4-(2-aminopropanoyl)-N-cyclohexyl-N-methylpiperazine-1-sulfonamide |
|---|---|
| PubChem CID | 119292580 |
| Molecular Formula | C14H28N4O3S |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | 4-(2-aminopropanoyl)-N-cyclohexyl-N-methylpiperazine-1-sulfonamide |
| SMILES | CC(N)C(=O)N1CCN(S(=O)(=O)N(C)C2CCCCC2)CC1 |
| InChI | InChI=1S/C14H28N4O3S/c1-12(15)14(19)17-8-10-18(11-9-17)22(20,21)16(2)13-6-4-3-5-7-13/h12-13H,3-11,15H2,1-2H3 |
| InChIKey | SNIDZGZYUNOMGC-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 86.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |